CAS 1255313-31-5 is the registry number for 5-(Dibromomethyl)-3-methylbenzo[d]oxazol-2(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(dibromomethyl)-3-methyl-1,3-benzoxazol-2-one (CAS 1255313-31-5) is a chemical compound with the molecular formula C9H7Br2NO2 and a molecular weight of 320.96 g/mol. IUPAC name: 5-(dibromomethyl)-3-methyl-1,3-benzoxazol-2-one. InChIKey: VEYSGZQGZLOCRX-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2NO2 |
|---|---|
| Molecular weight | 320.96 g/mol |
| IUPAC name | 5-(dibromomethyl)-3-methyl-1,3-benzoxazol-2-one |
| InChIKey | VEYSGZQGZLOCRX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(Br)Br)OC1=O |
Computed by PubChem (NCBI)