CAS 886854-04-2 is the registry number for 1-(2-2-Dibromovinyl)-3-methyl-2-nitrobenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
1-(2,2-dibromoethenyl)-3-methyl-2-nitrobenzene (CAS 886854-04-2) is a chemical compound with the molecular formula C9H7Br2NO2 and a molecular weight of 320.96 g/mol. IUPAC name: 1-(2,2-dibromoethenyl)-3-methyl-2-nitrobenzene. InChIKey: FYJDMAUTUHQASI-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2NO2 |
|---|---|
| Molecular weight | 320.96 g/mol |
| IUPAC name | 1-(2,2-dibromoethenyl)-3-methyl-2-nitrobenzene |
| InChIKey | FYJDMAUTUHQASI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C=C(Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)