CAS 1255525-18-8 appears in our catalog under these names: Tenofovir Impurity 152, Ethyl hydrogen ((((S)-1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg.
[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphinic acid (CAS 1255525-18-8) is a chemical compound with the molecular formula C11H18N5O4P and a molecular weight of 315.27 g/mol. IUPAC name: [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphinic acid. InChIKey: RKTDGEHXFPNCDC-QMMMGPOBSA-N.
| Molecular formula | C11H18N5O4P |
|---|---|
| Molecular weight | 315.27 g/mol |
| IUPAC name | [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-ethoxyphosphinic acid |
| InChIKey | RKTDGEHXFPNCDC-QMMMGPOBSA-N |
| SMILES | CCOP(=O)(CO[C@@H](C)CN1C=NC2=C(N=CN=C21)N)O |
Computed by PubChem (NCBI)