CAS 1878175-74-6 appears in our catalog under these names: Tenofovir disoproxil Impurity 18, (R)-(((1-(6-(Ethylamino)-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-1-[6-(ethylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid (CAS 1878175-74-6) is a chemical compound with the molecular formula C11H18N5O4P and a molecular weight of 315.27 g/mol. IUPAC name: [(2R)-1-[6-(ethylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid. InChIKey: VBXONVDFKGIIGO-MRVPVSSYSA-N.
| Molecular formula | C11H18N5O4P |
|---|---|
| Molecular weight | 315.27 g/mol |
| IUPAC name | [(2R)-1-[6-(ethylamino)purin-9-yl]propan-2-yl]oxymethylphosphonic acid |
| InChIKey | VBXONVDFKGIIGO-MRVPVSSYSA-N |
| SMILES | CCNC1=C2C(=NC=N1)N(C=N2)C[C@@H](C)OCP(=O)(O)O |
Computed by PubChem (NCBI)