CAS 1255574-39-0 is the registry number for Benzyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Benzyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate (CAS 1255574-39-0) is a chemical compound with the molecular formula C17H16ClNO2 and a molecular weight of 301.8 g/mol. IUPAC name: benzyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate. InChIKey: NTLIQLRJAQUQTM-UHFFFAOYSA-N.
| Molecular formula | C17H16ClNO2 |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | benzyl N-[1-(3-chlorophenyl)cyclopropyl]carbamate |
| InChIKey | NTLIQLRJAQUQTM-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC=C2)Cl)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)