Products 749896-89-7
CAS 749896-89-7 is the registry number for N-(2-Chloro-4,6-dimethylphenyl)-3-oxo-3-phenylpropanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
N-(2-chloro-4,6-dimethylphenyl)-3-oxo-3-phenylpropanamide (CAS 749896-89-7) is a chemical compound with the molecular formula C17H16ClNO2 and a molecular weight of 301.8 g/mol. IUPAC name: N-(2-chloro-4,6-dimethylphenyl)-3-oxo-3-phenylpropanamide. InChIKey: COOIFIYJPGQGRS-UHFFFAOYSA-N.
| Molecular formula | C17H16ClNO2 |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | N-(2-chloro-4,6-dimethylphenyl)-3-oxo-3-phenylpropanamide |
| InChIKey | COOIFIYJPGQGRS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)NC(=O)CC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)