CAS 1255574-48-1 appears in our catalog under these names: Methyl 3-bromo-5-isopropoxybenzoate, 98%, Methyl 3-bromo-5-isopropoxybenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 5g.
Methyl 3-bromo-5-propan-2-yloxybenzoate (CAS 1255574-48-1) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: methyl 3-bromo-5-propan-2-yloxybenzoate. InChIKey: ITWYJGXJJZTWSQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | methyl 3-bromo-5-propan-2-yloxybenzoate |
| InChIKey | ITWYJGXJJZTWSQ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)