Products 1255663-98-9

CAS 1255663-98-9 is the registry number for Dimethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate (CAS 1255663-98-9) is a chemical compound with the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. IUPAC name: dimethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate. InChIKey: KQXKRUDATDKFEL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO6
Molecular weight319.31 g/mol
IUPAC namedimethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate
InChIKeyKQXKRUDATDKFEL-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(N(CC1=O)C(=O)C2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)