CAS 53937-11-4 is the registry number for Diethyl 6-hydroxy-2-methyl-1-oxo-1,2-dihydroisoquinoline-5,7-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 6-hydroxy-2-methyl-1-oxoisoquinoline-5,7-dicarboxylate (CAS 53937-11-4) is a chemical compound with the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. IUPAC name: diethyl 6-hydroxy-2-methyl-1-oxoisoquinoline-5,7-dicarboxylate. InChIKey: MEOLAIISLOYCOM-UHFFFAOYSA-N.
| Molecular formula | C16H17NO6 |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | diethyl 6-hydroxy-2-methyl-1-oxoisoquinoline-5,7-dicarboxylate |
| InChIKey | MEOLAIISLOYCOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C2C=CN(C(=O)C2=C1)C)C(=O)OCC)O |
Computed by PubChem (NCBI)