CAS 1255717-06-6 appears in our catalog under these names: ([1-(4-Fluorophenyl)-3,5-dimethyl-1h-pyrazol-4-yl]methyl)amine hydrochloride, 95%, (1-(4-Fluorophenyl)-3,5-dimethyl-1H-pyrazol-4-yl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanamine;hydrochloride (CAS 1255717-06-6) is a chemical compound with the molecular formula C12H15ClFN3 and a molecular weight of 255.72 g/mol. IUPAC name: [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanamine;hydrochloride. InChIKey: TUMSAPBILBJOCF-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFN3 |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]methanamine;hydrochloride |
| InChIKey | TUMSAPBILBJOCF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)F)C)CN.Cl |
Computed by PubChem (NCBI)