CAS 2490705-36-5 appears in our catalog under these names: 2-(4-Fluorophenyl)-2-(4-methyl-1H-pyrazol-1-yl)ethan-1-amine hydrochloride, 95%, 2-(4-Fluorophenyl)-2-(4-methyl-1H-pyrazol-1-yl)ethan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
2-(4-fluorophenyl)-2-(4-methylpyrazol-1-yl)ethanamine;hydrochloride (CAS 2490705-36-5) is a chemical compound with the molecular formula C12H15ClFN3 and a molecular weight of 255.72 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-(4-methylpyrazol-1-yl)ethanamine;hydrochloride. InChIKey: LSWFQKICMNGYHP-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFN3 |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-(4-methylpyrazol-1-yl)ethanamine;hydrochloride |
| InChIKey | LSWFQKICMNGYHP-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)C(CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)