Products 1255785-35-3
CAS 1255785-35-3 is the registry number for 2-(4-Fluorophenyl)-3-(hydroxymethyl)-5-methylpyrazolo[1,5-a]pyrazin-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-(4-fluorophenyl)-3-(hydroxymethyl)-5-methylpyrazolo[1,5-a]pyrazin-4-one (CAS 1255785-35-3) is a chemical compound with the molecular formula C14H12FN3O2 and a molecular weight of 273.26 g/mol. IUPAC name: 2-(4-fluorophenyl)-3-(hydroxymethyl)-5-methylpyrazolo[1,5-a]pyrazin-4-one. InChIKey: LMDOCRCHNNUNNW-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O2 |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-3-(hydroxymethyl)-5-methylpyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | LMDOCRCHNNUNNW-UHFFFAOYSA-N |
| SMILES | CN1C=CN2C(=C(C(=N2)C3=CC=C(C=C3)F)CO)C1=O |
Computed by PubChem (NCBI)