Products 1395492-92-8
CAS 1395492-92-8 is the registry number for 2-(4-Fluoro-phenyl)-7,8-dihydro-5h-pyrido[4,3-d]pyrimidine-6-carboxylic acidtert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylic acid (CAS 1395492-92-8) is a chemical compound with the molecular formula C14H12FN3O2 and a molecular weight of 273.26 g/mol. IUPAC name: 2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylic acid. InChIKey: UMORPOGOIAMBJC-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O2 |
|---|---|
| Molecular weight | 273.26 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | UMORPOGOIAMBJC-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CN=C(N=C21)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)