CAS 1255787-96-2 is the registry number for 5,6-Dimethyl-2-(methylthio)-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethyl-2-methylsulfanyl-3H-pyrrolo[3,2-d]pyrimidin-4-one (CAS 1255787-96-2) is a chemical compound with the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. IUPAC name: 5,6-dimethyl-2-methylsulfanyl-3H-pyrrolo[3,2-d]pyrimidin-4-one. InChIKey: IJPFHIKVHGFZFH-UHFFFAOYSA-N.
| Molecular formula | C9H11N3OS |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 5,6-dimethyl-2-methylsulfanyl-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | IJPFHIKVHGFZFH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C)C(=O)NC(=N2)SC |
Computed by PubChem (NCBI)