CAS 80381-63-1 is the registry number for 3-Amino-2,5,6-trimethylthieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-amino-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one (CAS 80381-63-1) is a chemical compound with the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. IUPAC name: 3-amino-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one. InChIKey: SVXIDPWZEHWIRT-UHFFFAOYSA-N.
| Molecular formula | C9H11N3OS |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 3-amino-2,5,6-trimethylthieno[2,3-d]pyrimidin-4-one |
| InChIKey | SVXIDPWZEHWIRT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C(=N2)C)N)C |
Computed by PubChem (NCBI)