Products 125602-69-9

CAS 125602-69-9 is the registry number for rac Bepotastine Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 4-[4-[(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoate (CAS 125602-69-9) is a chemical compound with the molecular formula C23H29ClN2O3 and a molecular weight of 416.9 g/mol. IUPAC name: ethyl 4-[4-[(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoate. InChIKey: PNUAKDVREOZEKA-UHFFFAOYSA-N.

Identity
Molecular formulaC23H29ClN2O3
Molecular weight416.9 g/mol
IUPAC nameethyl 4-[4-[(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoate
InChIKeyPNUAKDVREOZEKA-UHFFFAOYSA-N
SMILESCCOC(=O)CCCN1CCC(CC1)OC(C2=CC=C(C=C2)Cl)C3=CC=CC=N3

Computed by PubChem (NCBI)