CAS 190730-39-3 appears in our catalog under these names: Bepotastine Ethyl Ester, >95% (HPLC), Bepotastine ethyl ester, Bepotastine Ethyl Ester Besylate, Bepotastine Impurity 5 (Bepotastine Ethyl Ester Besylate). Offered by: TRC, Biosynth, Chemat Brand, Hubei YoungXin. Available pack sizes: 100mg, 500mg, 50mg, 250mg, on request, 10mg, 25mg, 200mg.
Ethyl 4-[4-[(S)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoate (CAS 190730-39-3) is a chemical compound with the molecular formula C23H29ClN2O3 and a molecular weight of 416.9 g/mol. IUPAC name: ethyl 4-[4-[(S)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoate. InChIKey: PNUAKDVREOZEKA-QHCPKHFHSA-N.
| Molecular formula | C23H29ClN2O3 |
|---|---|
| Molecular weight | 416.9 g/mol |
| IUPAC name | ethyl 4-[4-[(S)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoate |
| InChIKey | PNUAKDVREOZEKA-QHCPKHFHSA-N |
| SMILES | CCOC(=O)CCCN1CCC(CC1)O[C@@H](C2=CC=C(C=C2)Cl)C3=CC=CC=N3 |
Computed by PubChem (NCBI)