Products 1256238-99-9
CAS 1256238-99-9 is the registry number for 1-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethan-1-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone (CAS 1256238-99-9) is a chemical compound with the molecular formula C7H12N2O and a molecular weight of 140.18 g/mol. IUPAC name: 1-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone. InChIKey: MKYKYZQDRKWIAT-RNFRBKRXSA-N.
| Molecular formula | C7H12N2O |
|---|---|
| Molecular weight | 140.18 g/mol |
| IUPAC name | 1-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone |
| InChIKey | MKYKYZQDRKWIAT-RNFRBKRXSA-N |
| SMILES | CC(=O)N1C[C@H]2C[C@@H]1CN2 |
Computed by PubChem (NCBI)