Products 1256345-87-5

CAS 1256345-87-5 is the registry number for 3-Ethoxy-5-(trifluoromethoxy)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[3-ethoxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1256345-87-5) is a chemical compound with the molecular formula C9H10BF3O4 and a molecular weight of 249.98 g/mol. IUPAC name: [3-ethoxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: CIBQUPSDYSPZER-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BF3O4
Molecular weight249.98 g/mol
IUPAC name[3-ethoxy-5-(trifluoromethoxy)phenyl]boronic acid
InChIKeyCIBQUPSDYSPZER-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)OC(F)(F)F)OCC)(O)O

Computed by PubChem (NCBI)