CAS 1704064-18-5 appears in our catalog under these names: (2-Ethoxy-4-(trifluoromethoxy)phenyl)boronic acid, 95%, (2–Ethoxy–4–(trifluoromethoxy)phenyl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 250mg, 1g, 500mg.
[2-ethoxy-4-(trifluoromethoxy)phenyl]boronic acid (CAS 1704064-18-5) is a chemical compound with the molecular formula C9H10BF3O4 and a molecular weight of 249.98 g/mol. IUPAC name: [2-ethoxy-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: NNNPPAHNTNNTRS-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O4 |
|---|---|
| Molecular weight | 249.98 g/mol |
| IUPAC name | [2-ethoxy-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | NNNPPAHNTNNTRS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)(F)F)OCC)(O)O |
Computed by PubChem (NCBI)