CAS 1256345-95-5 appears in our catalog under these names: 3-(Benzyloxy)-5-(trifluoromethoxy)phenylboronic acid, 96%, (3-(Benzyloxy)-5-(trifluoromethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
[3-phenylmethoxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1256345-95-5) is a chemical compound with the molecular formula C14H12BF3O4 and a molecular weight of 312.05 g/mol. IUPAC name: [3-phenylmethoxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: BDELXVOPRDLJAU-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O4 |
|---|---|
| Molecular weight | 312.05 g/mol |
| IUPAC name | [3-phenylmethoxy-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | BDELXVOPRDLJAU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC(F)(F)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)