CAS 1562343-86-5 appears in our catalog under these names: 4-Benzyloxy-2-(trifluoromethoxy)phenylboronic acid, 95%, (4-(Benzyloxy)-2-(trifluoromethoxy)phenyl)boronic acid, 98%, 4-Benzyloxy-2-(trifluoromethoxy)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
[4-phenylmethoxy-2-(trifluoromethoxy)phenyl]boronic acid (CAS 1562343-86-5) is a chemical compound with the molecular formula C14H12BF3O4 and a molecular weight of 312.05 g/mol. IUPAC name: [4-phenylmethoxy-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: CHCQIAAVRUVYIC-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O4 |
|---|---|
| Molecular weight | 312.05 g/mol |
| IUPAC name | [4-phenylmethoxy-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | CHCQIAAVRUVYIC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)