CAS 1256346-43-6 appears in our catalog under these names: 5-Bromo-3,4-difluoro-2-methoxyphenylboronic acid, 95%, (5-Bromo-3,4-difluoro-2-methoxyphenyl)boronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(5-bromo-3,4-difluoro-2-methoxyphenyl)boronic acid (CAS 1256346-43-6) is a chemical compound with the molecular formula C7H6BBrF2O3 and a molecular weight of 266.83 g/mol. IUPAC name: (5-bromo-3,4-difluoro-2-methoxyphenyl)boronic acid. InChIKey: IBSPNDUNUBIEKB-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF2O3 |
|---|---|
| Molecular weight | 266.83 g/mol |
| IUPAC name | (5-bromo-3,4-difluoro-2-methoxyphenyl)boronic acid |
| InChIKey | IBSPNDUNUBIEKB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1OC)F)F)Br)(O)O |
Computed by PubChem (NCBI)