CAS 2096337-64-1 appears in our catalog under these names: 5-Bromo-2,3-difluoro-4-methoxyphenylboronic acid, 95%, (5-Bromo-2,3-difluoro-4-methoxyphenyl)boronic acid 97%, 5-Bromo-2,3-difluoro-4-methoxyphenylboronic acid, 97%, 97%, 5-Bromo-2,3-difluoro-4-methoxyphenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid (CAS 2096337-64-1) is a chemical compound with the molecular formula C7H6BBrF2O3 and a molecular weight of 266.83 g/mol. IUPAC name: (5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid. InChIKey: QWHLPUWLRAUTMV-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF2O3 |
|---|---|
| Molecular weight | 266.83 g/mol |
| IUPAC name | (5-bromo-2,3-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | QWHLPUWLRAUTMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)OC)Br)(O)O |
Computed by PubChem (NCBI)