Products 1256355-10-8

CAS 1256355-10-8 appears in our catalog under these names: 3-Bromo-5-morpholinophenylboronic acid, 96%, (3-Bromo-5-morpholinophenyl)boronic acid, 98%, 3–Bromo–5–(morpholino)phenylboronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 25mg.

Structural formula: {0} (CAS {1})

(3-bromo-5-morpholin-4-ylphenyl)boronic acid (CAS 1256355-10-8) is a chemical compound with the molecular formula C10H13BBrNO3 and a molecular weight of 285.93 g/mol. IUPAC name: (3-bromo-5-morpholin-4-ylphenyl)boronic acid. InChIKey: UWNLKBOIZQUEHF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BBrNO3
Molecular weight285.93 g/mol
IUPAC name(3-bromo-5-morpholin-4-ylphenyl)boronic acid
InChIKeyUWNLKBOIZQUEHF-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)Br)N2CCOCC2)(O)O

Computed by PubChem (NCBI)