Products 2121512-78-3
CAS 2121512-78-3 appears in our catalog under these names: 5-Bromo-3-(N-propylaminocarbonyl)phenylboronic acid, 5-Bromo-3-(n-propylaminocarbonyl)phenylboronic acid, 95%, (3-Bromo-5-(propylcarbamoyl)phenyl)boronic acid, 98%, Boronic acid, B-[3-bromo-5-[(propylamino)carbonyl]phenyl]-, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.
[3-bromo-5-(propylcarbamoyl)phenyl]boronic acid (CAS 2121512-78-3) is a chemical compound with the molecular formula C10H13BBrNO3 and a molecular weight of 285.93 g/mol. IUPAC name: [3-bromo-5-(propylcarbamoyl)phenyl]boronic acid. InChIKey: NUJQDJJXOLSAOM-UHFFFAOYSA-N.
| Molecular formula | C10H13BBrNO3 |
|---|---|
| Molecular weight | 285.93 g/mol |
| IUPAC name | [3-bromo-5-(propylcarbamoyl)phenyl]boronic acid |
| InChIKey | NUJQDJJXOLSAOM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(=O)NCCC)(O)O |
Computed by PubChem (NCBI)