CAS 1256355-32-4 appears in our catalog under these names: 4–Amino–3–fluorophenylboronic acid hydrochloride, 4-AMINO-3-FLUOROPHENYLBORONIC ACID HYD, 4-Amino-3-fluorophenylboronic acid hydrochloride, 95%, (4-Amino-3-fluorophenyl)boronic acid hydrochloride 95%, 4-Amino-3-fluorophenylboronic acid, HCl, 95%, 95%. Offered by: GLPBio, Sigma-Aldrich, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
(4-amino-3-fluorophenyl)boronic acid;hydrochloride (CAS 1256355-32-4) is a chemical compound with the molecular formula C6H8BClFNO2 and a molecular weight of 191.40 g/mol. IUPAC name: (4-amino-3-fluorophenyl)boronic acid;hydrochloride. InChIKey: NXCNVCKJELIVDM-UHFFFAOYSA-N.
| Molecular formula | C6H8BClFNO2 |
|---|---|
| Molecular weight | 191.40 g/mol |
| IUPAC name | (4-amino-3-fluorophenyl)boronic acid;hydrochloride |
| InChIKey | NXCNVCKJELIVDM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N)F)(O)O.Cl |
Computed by PubChem (NCBI)