Products 1256355-65-3

CAS 1256355-65-3 is the registry number for 5-Amino-2-fluorophenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(5-amino-2-fluorophenyl)boronic acid;hydrochloride (CAS 1256355-65-3) is a chemical compound with the molecular formula C6H8BClFNO2 and a molecular weight of 191.40 g/mol. IUPAC name: (5-amino-2-fluorophenyl)boronic acid;hydrochloride. InChIKey: CLVCJRRSLDMQIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BClFNO2
Molecular weight191.40 g/mol
IUPAC name(5-amino-2-fluorophenyl)boronic acid;hydrochloride
InChIKeyCLVCJRRSLDMQIJ-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)N)F)(O)O.Cl

Computed by PubChem (NCBI)