Products 1256358-49-2

CAS 1256358-49-2 is the registry number for 2-(4-Fluorophenylmethoxy)-5-methylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]boronic acid (CAS 1256358-49-2) is a chemical compound with the molecular formula C14H14BFO3 and a molecular weight of 260.07 g/mol. IUPAC name: [2-[(4-fluorophenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: UKXCDUUQXMHAFL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14BFO3
Molecular weight260.07 g/mol
IUPAC name[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]boronic acid
InChIKeyUKXCDUUQXMHAFL-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)C)OCC2=CC=C(C=C2)F)(O)O

Computed by PubChem (NCBI)