Products 1311166-12-7
CAS 1311166-12-7 appears in our catalog under these names: (5-Fluoro-2-(2-phenylethoxy)phenyl)boronic acid, [5-fluoro-2-(2-phenylethoxy)phenyl]boronic acid, 97%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 5g.
[5-fluoro-2-(2-phenylethoxy)phenyl]boronic acid (CAS 1311166-12-7) is a chemical compound with the molecular formula C14H14BFO3 and a molecular weight of 260.07 g/mol. IUPAC name: [5-fluoro-2-(2-phenylethoxy)phenyl]boronic acid. InChIKey: UPUKFGZSYHLUCB-UHFFFAOYSA-N.
| Molecular formula | C14H14BFO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | [5-fluoro-2-(2-phenylethoxy)phenyl]boronic acid |
| InChIKey | UPUKFGZSYHLUCB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OCCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)