CAS 1256360-10-7 appears in our catalog under these names: 1-(Ethylsulfonyl)pyrrole-3-boronic acid, pinacol ester, 97%, 1-(Ethylsulfonyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1256360-10-7) is a chemical compound with the molecular formula C12H20BNO4S and a molecular weight of 285.17 g/mol. IUPAC name: 1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: MIFWZDZTMHOMRV-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO4S |
|---|---|
| Molecular weight | 285.17 g/mol |
| IUPAC name | 1-ethylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | MIFWZDZTMHOMRV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)S(=O)(=O)CC |
Computed by PubChem (NCBI)