CAS 1704067-22-0 appears in our catalog under these names: (4-(N,N-Diethylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, (4–(N,N–Diethylsulfamoyl)–3,5–dimethylphenyl)boronic acid, Boronic acid, B-[4-[(diethylamino)sulfonyl]-3,5-dimethylphenyl]-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 500mg.
[4-(diethylsulfamoyl)-3,5-dimethylphenyl]boronic acid (CAS 1704067-22-0) is a chemical compound with the molecular formula C12H20BNO4S and a molecular weight of 285.17 g/mol. IUPAC name: [4-(diethylsulfamoyl)-3,5-dimethylphenyl]boronic acid. InChIKey: PHMYJQTZLISWIU-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO4S |
|---|---|
| Molecular weight | 285.17 g/mol |
| IUPAC name | [4-(diethylsulfamoyl)-3,5-dimethylphenyl]boronic acid |
| InChIKey | PHMYJQTZLISWIU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)N(CC)CC)C)(O)O |
Computed by PubChem (NCBI)