CAS 1256360-14-1 appears in our catalog under these names: 1-(Methoxymethyl)indazole-6-boronic acid, pinacol ester, 96%, 1-(Methoxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-(methoxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1256360-14-1) is a chemical compound with the molecular formula C15H21BN2O3 and a molecular weight of 288.15 g/mol. IUPAC name: 1-(methoxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: MBNXZYJYGJNABY-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O3 |
|---|---|
| Molecular weight | 288.15 g/mol |
| IUPAC name | 1-(methoxymethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | MBNXZYJYGJNABY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3COC |
Computed by PubChem (NCBI)