Products 1647115-89-6
CAS 1647115-89-6 is the registry number for 6-Methoxy-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methoxy-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1647115-89-6) is a chemical compound with the molecular formula C15H21BN2O3 and a molecular weight of 288.15 g/mol. IUPAC name: 6-methoxy-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: FFYNMDCJSFWPJI-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O3 |
|---|---|
| Molecular weight | 288.15 g/mol |
| IUPAC name | 6-methoxy-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | FFYNMDCJSFWPJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CN(N=C3C=C2OC)C |
Computed by PubChem (NCBI)