CAS 1256380-16-1 is the registry number for 4-cis-Decenoylcarnitine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
(3R)-3-[(Z)-dec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate (CAS 1256380-16-1) is a chemical compound with the molecular formula C17H31NO4 and a molecular weight of 313.4 g/mol. IUPAC name: (3R)-3-[(Z)-dec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate. InChIKey: OQWOHRPOYAVIOK-FJVVXJACSA-N.
| Molecular formula | C17H31NO4 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | (3R)-3-[(Z)-dec-4-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| InChIKey | OQWOHRPOYAVIOK-FJVVXJACSA-N |
| SMILES | CCCCC/C=C\CCC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
Computed by PubChem (NCBI)