CAS 2598983-48-1 is the registry number for Methyl (S,E)-5-((tert-butoxycarbonyl)amino)-2,2,7-trimethyloct-3-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E,5S)-2,2,7-trimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoate (CAS 2598983-48-1) is a chemical compound with the molecular formula C17H31NO4 and a molecular weight of 313.4 g/mol. IUPAC name: methyl (E,5S)-2,2,7-trimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoate. InChIKey: QGBUDRZXWGWALH-WTNCMQEWSA-N.
| Molecular formula | C17H31NO4 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | methyl (E,5S)-2,2,7-trimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oct-3-enoate |
| InChIKey | QGBUDRZXWGWALH-WTNCMQEWSA-N |
| SMILES | CC(C)C[C@@H](/C=C/C(C)(C)C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)