Products 1256481-56-7

CAS 1256481-56-7 is the registry number for Ethyl 4-octyl-α-oxobenzeneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-octylphenyl)-2-oxoacetate (CAS 1256481-56-7) is a chemical compound with the molecular formula C18H26O3 and a molecular weight of 290.4 g/mol. IUPAC name: ethyl 2-(4-octylphenyl)-2-oxoacetate. InChIKey: VBLGTFXOFMTFDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H26O3
Molecular weight290.4 g/mol
IUPAC nameethyl 2-(4-octylphenyl)-2-oxoacetate
InChIKeyVBLGTFXOFMTFDJ-UHFFFAOYSA-N
SMILESCCCCCCCCC1=CC=C(C=C1)C(=O)C(=O)OCC

Computed by PubChem (NCBI)