CAS 1315604-10-4 appears in our catalog under these names: 5-(2,5-Dimethyl-4-(prop-1-enyl)phenoxy)-2,2-dimethylpentanoic Acid, Gemfibrozil Impurity E (as (E)-Isomer). Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
5-[2,5-dimethyl-4-[(E)-prop-1-enyl]phenoxy]-2,2-dimethylpentanoic acid (CAS 1315604-10-4) is a chemical compound with the molecular formula C18H26O3 and a molecular weight of 290.4 g/mol. IUPAC name: 5-[2,5-dimethyl-4-[(E)-prop-1-enyl]phenoxy]-2,2-dimethylpentanoic acid. InChIKey: ZWBXHPOXWIJOJR-SOFGYWHQSA-N.
| Molecular formula | C18H26O3 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 5-[2,5-dimethyl-4-[(E)-prop-1-enyl]phenoxy]-2,2-dimethylpentanoic acid |
| InChIKey | ZWBXHPOXWIJOJR-SOFGYWHQSA-N |
| SMILES | C/C=C/C1=C(C=C(C(=C1)C)OCCCC(C)(C)C(=O)O)C |
Computed by PubChem (NCBI)