CAS 1256584-72-1 appears in our catalog under these names: 2-Methyl-2-(4-vinylphenyl)propanoic acid, 95%, 2-methyl-2-(4-vinylphenyl)propanoic acid, 97%, 97%, 2-Methyl-2-(4-vinylphenyl)propanoic acid, 98%, 2-Methyl-2-(4-vinylphenyl)propanoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2-(4-ethenylphenyl)-2-methylpropanoic acid (CAS 1256584-72-1) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2-(4-ethenylphenyl)-2-methylpropanoic acid. InChIKey: XDMQQLNDUWSLSK-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2-(4-ethenylphenyl)-2-methylpropanoic acid |
| InChIKey | XDMQQLNDUWSLSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C=C)C(=O)O |
Computed by PubChem (NCBI)