CAS 1256633-33-6 appears in our catalog under these names: Methyl 4,5-di(1-imidazolyl)-2-nitrobenzoate, 95%, Methyl 4,5–Di(1–imidazolyl)–2–nitrobenzoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
Methyl 4,5-di(imidazol-1-yl)-2-nitrobenzoate (CAS 1256633-33-6) is a chemical compound with the molecular formula C14H11N5O4 and a molecular weight of 313.27 g/mol. IUPAC name: methyl 4,5-di(imidazol-1-yl)-2-nitrobenzoate. InChIKey: WDEMOZOGTCVBEX-UHFFFAOYSA-N.
| Molecular formula | C14H11N5O4 |
|---|---|
| Molecular weight | 313.27 g/mol |
| IUPAC name | methyl 4,5-di(imidazol-1-yl)-2-nitrobenzoate |
| InChIKey | WDEMOZOGTCVBEX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])N2C=CN=C2)N3C=CN=C3 |
Computed by PubChem (NCBI)