CAS 1616668-55-3 appears in our catalog under these names: Tetrazine-NHS ester, min. 95 %, 500 mg, Tetrazine-nhs ester, 95%, Tetrazine–Ph–NHS ester, Tetrazine-NHS ester, Tetrazine-NHS Ester, >98.0%(HPLC). Offered by: Roth, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 500mg, 1g, 100mg, 25mg, 50mg, 10mg, 250mg, 5 mg.
(2,5-dioxopyrrolidin-1-yl) 2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetate (CAS 1616668-55-3) is a chemical compound with the molecular formula C14H11N5O4 and a molecular weight of 313.27 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetate. InChIKey: ORWDYVDDJMYIQA-UHFFFAOYSA-N.
| Molecular formula | C14H11N5O4 |
|---|---|
| Molecular weight | 313.27 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetate |
| InChIKey | ORWDYVDDJMYIQA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CC2=CC=C(C=C2)C3=NN=CN=N3 |
Computed by PubChem (NCBI)