CAS 1256643-55-6 appears in our catalog under these names: 5,7-Dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride, 95%, 8-iso Misoprostol. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, 250mg, on request.
5,7-dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride (CAS 1256643-55-6) is a chemical compound with the molecular formula C8H7ClN2O3S and a molecular weight of 246.67 g/mol. IUPAC name: 5,7-dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride. InChIKey: KFIKFRDBDZKOMA-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3S |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | 5,7-dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride |
| InChIKey | KFIKFRDBDZKOMA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=NON=C12)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)