CAS 1023816-32-1 is the registry number for 6-Methyl-2-oxo-2,3-dihydro-1h-benzimidazole-5-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
6-methyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonyl chloride (CAS 1023816-32-1) is a chemical compound with the molecular formula C8H7ClN2O3S and a molecular weight of 246.67 g/mol. IUPAC name: 6-methyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonyl chloride. InChIKey: UUBTWOONDOQAOZ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3S |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | 6-methyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonyl chloride |
| InChIKey | UUBTWOONDOQAOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1S(=O)(=O)Cl)NC(=O)N2 |
Computed by PubChem (NCBI)