Products 1256781-75-5
CAS 1256781-75-5 appears in our catalog under these names: (5-Iodo-2-methoxyphenyl)boronic acid, 97%, (5-Iodo-2-methoxyphenyl)boronic acid, 98%, (5-Iodo-2-methoxyphenyl)boronic acid, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(5-iodo-2-methoxyphenyl)boronic acid (CAS 1256781-75-5) is a chemical compound with the molecular formula C7H8BIO3 and a molecular weight of 277.85 g/mol. IUPAC name: (5-iodo-2-methoxyphenyl)boronic acid. InChIKey: IFHSCVSQPKTMCY-UHFFFAOYSA-N.
| Molecular formula | C7H8BIO3 |
|---|---|
| Molecular weight | 277.85 g/mol |
| IUPAC name | (5-iodo-2-methoxyphenyl)boronic acid |
| InChIKey | IFHSCVSQPKTMCY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)I)OC)(O)O |
Computed by PubChem (NCBI)