CAS 89694-50-8 appears in our catalog under these names: (2-Iodo-5-methoxyphenyl)boronic acid, 95%, 2-Iodo-5-methoxyphenylboronic acid, 95-<97%, (2-Iodo-5-methoxyphenyl)boronic Acid, >95% (HPLC), MIBA, 96%, (2-Iodo-5-methoxyphenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 200g, 300g, 400g.
(2-iodo-5-methoxyphenyl)boronic acid (CAS 89694-50-8) is a chemical compound with the molecular formula C7H8BIO3 and a molecular weight of 277.85 g/mol. IUPAC name: (2-iodo-5-methoxyphenyl)boronic acid. InChIKey: XQYAEIDOJUNIGY-UHFFFAOYSA-N.
| Molecular formula | C7H8BIO3 |
|---|---|
| Molecular weight | 277.85 g/mol |
| IUPAC name | (2-iodo-5-methoxyphenyl)boronic acid |
| InChIKey | XQYAEIDOJUNIGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)I)(O)O |
Computed by PubChem (NCBI)