CAS 1256791-53-3 appears in our catalog under these names: 6-Chloro-4-cyanonicotinic acid, 98%, 6-Chloro-4-cyanonicotinic acid 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
6-chloro-4-cyanopyridine-3-carboxylic acid (CAS 1256791-53-3) is a chemical compound with the molecular formula C7H3ClN2O2 and a molecular weight of 182.56 g/mol. IUPAC name: 6-chloro-4-cyanopyridine-3-carboxylic acid. InChIKey: OBVSBUPKQVJVQG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2 |
|---|---|
| Molecular weight | 182.56 g/mol |
| IUPAC name | 6-chloro-4-cyanopyridine-3-carboxylic acid |
| InChIKey | OBVSBUPKQVJVQG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C(=O)O)C#N |
Computed by PubChem (NCBI)