Products 1256824-19-7
CAS 1256824-19-7 is the registry number for 3-Chloro-6-cyanopicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-6-cyanopyridine-2-carboxylic acid (CAS 1256824-19-7) is a chemical compound with the molecular formula C7H3ClN2O2 and a molecular weight of 182.56 g/mol. IUPAC name: 3-chloro-6-cyanopyridine-2-carboxylic acid. InChIKey: IXLYTAXWGZWMKO-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2 |
|---|---|
| Molecular weight | 182.56 g/mol |
| IUPAC name | 3-chloro-6-cyanopyridine-2-carboxylic acid |
| InChIKey | IXLYTAXWGZWMKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1C#N)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-6-cyanopicolinic acid