Products 1256808-87-3

CAS 1256808-87-3 is the registry number for Methyl 6-chloro-5-hydroxypyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 6-chloro-5-hydroxypyridine-2-carboxylate (CAS 1256808-87-3) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: methyl 6-chloro-5-hydroxypyridine-2-carboxylate. InChIKey: WHAOZRVKYQVKQD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO3
Molecular weight187.58 g/mol
IUPAC namemethyl 6-chloro-5-hydroxypyridine-2-carboxylate
InChIKeyWHAOZRVKYQVKQD-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=C(C=C1)O)Cl

Computed by PubChem (NCBI)