CAS 1256815-06-1 is the registry number for 2-[(1,3-Dihydro-1,3-dioxo-2h-isoindol-2-yl)methyl]-1,4-piperazinedicarboxylic acid 1,4-bis(1,1-dimethylethyl) ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ditert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-1,4-dicarboxylate (CAS 1256815-06-1) is a chemical compound with the molecular formula C23H31N3O6 and a molecular weight of 445.5 g/mol. IUPAC name: ditert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-1,4-dicarboxylate. InChIKey: LITNIKUYVXZSRX-UHFFFAOYSA-N.
| Molecular formula | C23H31N3O6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | ditert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]piperazine-1,4-dicarboxylate |
| InChIKey | LITNIKUYVXZSRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)CN2C(=O)C3=CC=CC=C3C2=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)