CAS 233691-67-3 appears in our catalog under these names: Boc-Lys(Ac)-AMC, Boc–Lys(Ac)–AMC, Boc-L-Lys(Ac)-AMC, Boc-Lys(Ac)-Amc-OH 95%, (S)-tert-Butyl (6-acetamido-1-((4-methyl-2-oxo-2H-chromen-7-yl)amino)-1-oxohexan-2-yl)carbamate, 95%, 95%. Offered by: TargetMol, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 10mg, 250mg, 10mM (in 1ml dmso), 50mg, 1g, 5g, 100mg, 25 mg.
Tert-butyl N-[(2S)-6-acetamido-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate (CAS 233691-67-3) is a chemical compound with the molecular formula C23H31N3O6 and a molecular weight of 445.5 g/mol. IUPAC name: tert-butyl N-[(2S)-6-acetamido-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate. InChIKey: SUTRDULVNIPNLW-SFHVURJKSA-N.
| Molecular formula | C23H31N3O6 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | tert-butyl N-[(2S)-6-acetamido-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate |
| InChIKey | SUTRDULVNIPNLW-SFHVURJKSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCCCNC(=O)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)